C21H15ClF2N4O3S — CID 136885565
(5S)-2-[(3-chlorophenyl)methylsulfanyl]-N-(2,5-difluorophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136885565) has the molecular formula C21H15ClF2N4O3S and a molecular weight of 476.89 g/mol. Its IUPAC name is (5S)-2-[(3-chlorophenyl)methylsulfanyl]-N-(2,5-difluorophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-2-[(3-chlorophenyl)methylsulfanyl]-N-(2,5-difluorophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136885565 |
| Molecular Formula | C21H15ClF2N4O3S |
| Molecular Weight | 476.89 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | (5S)-2-[(3-chlorophenyl)methylsulfanyl]-N-(2,5-difluorophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | O=C1C[C@H](C(=O)Nc2cc(F)ccc2F)c2c(nc(SCc3cccc(Cl)c3)[nH]c2=O)N1 |
| InChI | InChI=1S/C21H15ClF2N4O3S/c22-11-3-1-2-10(6-11)9-32-21-27-18-17(20(31)28-21)13(8-16(29)26-18)19(30)25-15-7-12(23)4-5-14(15)24/h1-7,13H,8-9H2,(H,25,30)(H2,26,27,28,29,31)/t13-/m0/s1 |
| InChIKey | UWBZROBGWLTZPC-ZDUSSCGKSA-N |
| XLogP | 4.06 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.89 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |