C21H17ClN4O3S — CID 136885140
(5R)-2-benzylsulfanyl-N-(3-chlorophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136885140) has the molecular formula C21H17ClN4O3S and a molecular weight of 440.91 g/mol. Its IUPAC name is (5R)-2-benzylsulfanyl-N-(3-chlorophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-2-benzylsulfanyl-N-(3-chlorophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136885140 |
| Molecular Formula | C21H17ClN4O3S |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | (5R)-2-benzylsulfanyl-N-(3-chlorophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | O=C1C[C@@H](C(=O)Nc2cccc(Cl)c2)c2c(nc(SCc3ccccc3)[nH]c2=O)N1 |
| InChI | InChI=1S/C21H17ClN4O3S/c22-13-7-4-8-14(9-13)23-19(28)15-10-16(27)24-18-17(15)20(29)26-21(25-18)30-11-12-5-2-1-3-6-12/h1-9,15H,10-11H2,(H,23,28)(H2,24,25,26,27,29)/t15-/m1/s1 |
| InChIKey | SEOUKMXJDOVIAJ-OAHLLOKOSA-N |
| XLogP | 3.78 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |