C18H17ClN4O3S — CID 135986646
N-(3-chloro-2-methylphenyl)-4,7-dioxo-2-prop-2-enylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 135986646) has the molecular formula C18H17ClN4O3S and a molecular weight of 404.88 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-4,7-dioxo-2-prop-2-enylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-4,7-dioxo-2-prop-2-enylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135986646 |
| Molecular Formula | C18H17ClN4O3S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-4,7-dioxo-2-prop-2-enylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | C=CCSc1nc2c(c(=O)[nH]1)C(C(=O)Nc1cccc(Cl)c1C)CC(=O)N2 |
| InChI | InChI=1S/C18H17ClN4O3S/c1-3-7-27-18-22-15-14(17(26)23-18)10(8-13(24)21-15)16(25)20-12-6-4-5-11(19)9(12)2/h3-6,10H,1,7-8H2,2H3,(H,20,25)(H2,21,22,23,24,26) |
| InChIKey | XAIHNMGAJNZZGF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|