C9H11NO2 — CID 177016784
3-buta-1,3-dien-2-ylpiperidine-2,6-dione (PubChem CID 177016784) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-buta-1,3-dien-2-ylpiperidine-2,6-dione.
| Compound Name | 3-buta-1,3-dien-2-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 177016784 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-buta-1,3-dien-2-ylpiperidine-2,6-dione |
| SMILES | C=CC(=C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C9H11NO2/c1-3-6(2)7-4-5-8(11)10-9(7)12/h3,7H,1-2,4-5H2,(H,10,11,12) |
| InChIKey | CCWIOOAQEQWUOG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|