C10H12N3O2+ — CID 170003315
[(Z)-1-(2,6-dioxopiperidin-3-yl)prop-1-enyl]iminomethyl-methylidyneazanium (PubChem CID 170003315) has the molecular formula C10H12N3O2+ and a molecular weight of 206.22 g/mol. Its IUPAC name is [(Z)-1-(2,6-dioxopiperidin-3-yl)prop-1-enyl]iminomethyl-methylidyneazanium.
| Compound Name | [(Z)-1-(2,6-dioxopiperidin-3-yl)prop-1-enyl]iminomethyl-methylidyneazanium |
|---|---|
| PubChem CID | 170003315 |
| Molecular Formula | C10H12N3O2+ |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | [(Z)-1-(2,6-dioxopiperidin-3-yl)prop-1-enyl]iminomethyl-methylidyneazanium |
| SMILES | C#[N+]/C=N/C(=C\C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C10H11N3O2/c1-3-8(12-6-11-2)7-4-5-9(14)13-10(7)15/h2-3,6-7H,4-5H2,1H3/p+1/b8-3-,12-6+ |
| InChIKey | NHXOJTMLEPTSQR-NSRAGWQASA-O |
| XLogP | 0.93 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|