C6H9NO3S — CID 155634994
3-methylsulfinylpiperidine-2,6-dione (PubChem CID 155634994) has the molecular formula C6H9NO3S and a molecular weight of 175.21 g/mol. Its IUPAC name is 3-methylsulfinylpiperidine-2,6-dione.
| Compound Name | 3-methylsulfinylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 155634994 |
| Molecular Formula | C6H9NO3S |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | 3-methylsulfinylpiperidine-2,6-dione |
| SMILES | CS(=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C6H9NO3S/c1-11(10)4-2-3-5(8)7-6(4)9/h4H,2-3H2,1H3,(H,7,8,9) |
| InChIKey | JEWVQBBAHOFEBX-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|