C7H10N2O4 — CID 145229496
N-(2,6-dioxopiperidin-3-yl)-N-hydroxyacetamide (PubChem CID 145229496) has the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-N-hydroxyacetamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-N-hydroxyacetamide |
|---|---|
| PubChem CID | 145229496 |
| Molecular Formula | C7H10N2O4 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-N-hydroxyacetamide |
| SMILES | CC(=O)N(O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C7H10N2O4/c1-4(10)9(13)5-2-3-6(11)8-7(5)12/h5,13H,2-3H2,1H3,(H,8,11,12) |
| InChIKey | NEYVYSXWLYOVGI-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|