C8H14N4O3 — CID 135296477
1-(2,6-dioxopiperidin-3-yl)-3-methyl-1-(methylamino)urea (PubChem CID 135296477) has the molecular formula C8H14N4O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 1-(2,6-dioxopiperidin-3-yl)-3-methyl-1-(methylamino)urea.
| Compound Name | 1-(2,6-dioxopiperidin-3-yl)-3-methyl-1-(methylamino)urea |
|---|---|
| PubChem CID | 135296477 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 1-(2,6-dioxopiperidin-3-yl)-3-methyl-1-(methylamino)urea |
| SMILES | CNC(=O)N(NC)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C8H14N4O3/c1-9-8(15)12(10-2)5-3-4-6(13)11-7(5)14/h5,10H,3-4H2,1-2H3,(H,9,15)(H,11,13,14) |
| InChIKey | YFPHOIDOEHVMCK-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|