C19H27F2N3O5 — CID 170313868
N'-(2,6-dioxopiperidin-3-yl)-2,2-difluoro-3-hydroxy-3-methyl-N'-[(Z)-2-methylidenehex-3-enoyl]hexanehydrazide (PubChem CID 170313868) has the molecular formula C19H27F2N3O5 and a molecular weight of 415.44 g/mol. Its IUPAC name is N'-(2,6-dioxopiperidin-3-yl)-2,2-difluoro-3-hydroxy-3-methyl-N'-[(Z)-2-methylidenehex-3-enoyl]hexanehydrazide.
| Compound Name | N'-(2,6-dioxopiperidin-3-yl)-2,2-difluoro-3-hydroxy-3-methyl-N'-[(Z)-2-methylidenehex-3-enoyl]hexanehydrazide |
|---|---|
| PubChem CID | 170313868 |
| Molecular Formula | C19H27F2N3O5 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N'-(2,6-dioxopiperidin-3-yl)-2,2-difluoro-3-hydroxy-3-methyl-N'-[(Z)-2-methylidenehex-3-enoyl]hexanehydrazide |
| SMILES | C=C(/C=C\CC)C(=O)N(NC(=O)C(F)(F)C(C)(O)CCC)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C19H27F2N3O5/c1-5-7-8-12(3)16(27)24(13-9-10-14(25)22-15(13)26)23-17(28)19(20,21)18(4,29)11-6-2/h7-8,13,29H,3,5-6,9-11H2,1-2,4H3,(H,23,28)(H,22,25,26)/b8-7- |
| InChIKey | OSMHOCDYVXNXIJ-FPLPWBNLSA-N |
| XLogP | 1.36 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|