C19H27N3O5 — CID 168945737
(2E,3Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethylidene-N-formyl-3-methylhexa-3,5-dienamide;N-methylpropanamide (PubChem CID 168945737) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is (2E,3Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethylidene-N-formyl-3-methylhexa-3,5-dienamide;N-methylpropanamide.
| Compound Name | (2E,3Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethylidene-N-formyl-3-methylhexa-3,5-dienamide;N-methylpropanamide |
|---|---|
| PubChem CID | 168945737 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (2E,3Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethylidene-N-formyl-3-methylhexa-3,5-dienamide;N-methylpropanamide |
| SMILES | C=C/C=C(C)\C(=C/C)C(=O)N(C=O)C1CCC(=O)NC1=O.CCC(=O)NC |
| InChI | InChI=1S/C15H18N2O4.C4H9NO/c1-4-6-10(3)11(5-2)15(21)17(9-18)12-7-8-13(19)16-14(12)20;1-3-4(6)5-2/h4-6,9,12H,1,7-8H2,2-3H3,(H,16,19,20);3H2,1-2H3,(H,5,6)/b10-6-,11-5+; |
| InChIKey | IAEOQZYEWORCTN-LPCIFZAASA-N |
| XLogP | 1.00 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|