C19H29N3O4 — CID 144742551
(E)-3-[(butanoylamino)methyl]-N-(2,6-dioxopiperidin-3-yl)-N-ethyl-2-methylidenehex-3-enamide (PubChem CID 144742551) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is (E)-3-[(butanoylamino)methyl]-N-(2,6-dioxopiperidin-3-yl)-N-ethyl-2-methylidenehex-3-enamide.
| Compound Name | (E)-3-[(butanoylamino)methyl]-N-(2,6-dioxopiperidin-3-yl)-N-ethyl-2-methylidenehex-3-enamide |
|---|---|
| PubChem CID | 144742551 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (E)-3-[(butanoylamino)methyl]-N-(2,6-dioxopiperidin-3-yl)-N-ethyl-2-methylidenehex-3-enamide |
| SMILES | C=C(C(=O)N(CC)C1CCC(=O)NC1=O)/C(=C\CC)CNC(=O)CCC |
| InChI | InChI=1S/C19H29N3O4/c1-5-8-14(12-20-16(23)9-6-2)13(4)19(26)22(7-3)15-10-11-17(24)21-18(15)25/h8,15H,4-7,9-12H2,1-3H3,(H,20,23)(H,21,24,25)/b14-8- |
| InChIKey | QGUFPHMJXQALOM-ZSOIEALJSA-N |
| XLogP | 1.45 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|