C16H19BrN2O3 — CID 176968593
N-(4-bromo-2-methylphenyl)-N-(2,6-dioxopiperidin-3-yl)butanamide (PubChem CID 176968593) has the molecular formula C16H19BrN2O3 and a molecular weight of 367.24 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-N-(2,6-dioxopiperidin-3-yl)butanamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-N-(2,6-dioxopiperidin-3-yl)butanamide |
|---|---|
| PubChem CID | 176968593 |
| Molecular Formula | C16H19BrN2O3 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-N-(2,6-dioxopiperidin-3-yl)butanamide |
| SMILES | CCCC(=O)N(c1ccc(Br)cc1C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C16H19BrN2O3/c1-3-4-15(21)19(12-6-5-11(17)9-10(12)2)13-7-8-14(20)18-16(13)22/h5-6,9,13H,3-4,7-8H2,1-2H3,(H,18,20,22) |
| InChIKey | WGQZZIVGWNSHCK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|