C26H40N2O4 — CID 176968166
N-(2,6-dioxopiperidin-3-yl)-N-[4-(3-heptan-4-yloxypropyl)-2-methylphenyl]butanamide (PubChem CID 176968166) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-N-[4-(3-heptan-4-yloxypropyl)-2-methylphenyl]butanamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-N-[4-(3-heptan-4-yloxypropyl)-2-methylphenyl]butanamide |
|---|---|
| PubChem CID | 176968166 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-N-[4-(3-heptan-4-yloxypropyl)-2-methylphenyl]butanamide |
| SMILES | CCCC(=O)N(c1ccc(CCCOC(CCC)CCC)cc1C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C26H40N2O4/c1-5-9-21(10-6-2)32-17-8-12-20-13-14-22(19(4)18-20)28(25(30)11-7-3)23-15-16-24(29)27-26(23)31/h13-14,18,21,23H,5-12,15-17H2,1-4H3,(H,27,29,31) |
| InChIKey | ZIANHWANWBKHIS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|