C18H25BrN2O3 — CID 176968592
N-(4-bromo-2-methylphenyl)-N-(2,6-dioxopiperidin-3-yl)butanamide;ethane (PubChem CID 176968592) has the molecular formula C18H25BrN2O3 and a molecular weight of 397.31 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-N-(2,6-dioxopiperidin-3-yl)butanamide;ethane.
| Compound Name | N-(4-bromo-2-methylphenyl)-N-(2,6-dioxopiperidin-3-yl)butanamide;ethane |
|---|---|
| PubChem CID | 176968592 |
| Molecular Formula | C18H25BrN2O3 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-N-(2,6-dioxopiperidin-3-yl)butanamide;ethane |
| SMILES | CC.CCCC(=O)N(c1ccc(Br)cc1C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C16H19BrN2O3.C2H6/c1-3-4-15(21)19(12-6-5-11(17)9-10(12)2)13-7-8-14(20)18-16(13)22;1-2/h5-6,9,13H,3-4,7-8H2,1-2H3,(H,18,20,22);1-2H3 |
| InChIKey | CZHIKGXLEXFXHQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|