C14H15BrN2O3 — CID 134579839
N-[(5-bromo-2-methylphenyl)methyl]-N-(2,6-dioxopiperidin-3-yl)formamide (PubChem CID 134579839) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is N-[(5-bromo-2-methylphenyl)methyl]-N-(2,6-dioxopiperidin-3-yl)formamide.
| Compound Name | N-[(5-bromo-2-methylphenyl)methyl]-N-(2,6-dioxopiperidin-3-yl)formamide |
|---|---|
| PubChem CID | 134579839 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | N-[(5-bromo-2-methylphenyl)methyl]-N-(2,6-dioxopiperidin-3-yl)formamide |
| SMILES | Cc1ccc(Br)cc1CN(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H15BrN2O3/c1-9-2-3-11(15)6-10(9)7-17(8-18)12-4-5-13(19)16-14(12)20/h2-3,6,8,12H,4-5,7H2,1H3,(H,16,19,20) |
| InChIKey | IGSOZUDMENYJOH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|