C28H35N5O5 — CID 167192386
N-[[5-[4-[2-[3-[(1R)-1-aminoethyl]phenoxy]acetyl]piperazin-1-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide (PubChem CID 167192386) has the molecular formula C28H35N5O5 and a molecular weight of 521.62 g/mol. Its IUPAC name is N-[[5-[4-[2-[3-[(1R)-1-aminoethyl]phenoxy]acetyl]piperazin-1-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide.
| Compound Name | N-[[5-[4-[2-[3-[(1R)-1-aminoethyl]phenoxy]acetyl]piperazin-1-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide |
|---|---|
| PubChem CID | 167192386 |
| Molecular Formula | C28H35N5O5 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | N-[[5-[4-[2-[3-[(1R)-1-aminoethyl]phenoxy]acetyl]piperazin-1-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide |
| SMILES | Cc1ccc(N2CCN(C(=O)COc3cccc([C@@H](C)N)c3)CC2)cc1CN(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C28H35N5O5/c1-19-6-7-23(14-22(19)16-33(18-34)25-8-9-26(35)30-28(25)37)31-10-12-32(13-11-31)27(36)17-38-24-5-3-4-21(15-24)20(2)29/h3-7,14-15,18,20,25H,8-13,16-17,29H2,1-2H3,(H,30,35,37)/t20-,25?/m1/s1 |
| InChIKey | CNDWNTGXOMXBES-VGOKPJQXSA-N |
| XLogP | 1.51 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|