C29H38ClN5O4 — CID 174237914
3-[6-[4-[4-[3-(1-aminoethyl)phenoxy]butyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride (PubChem CID 174237914) has the molecular formula C29H38ClN5O4 and a molecular weight of 556.11 g/mol. Its IUPAC name is 3-[6-[4-[4-[3-(1-aminoethyl)phenoxy]butyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[6-[4-[4-[3-(1-aminoethyl)phenoxy]butyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 174237914 |
| Molecular Formula | C29H38ClN5O4 |
| Molecular Weight | 556.11 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 3-[6-[4-[4-[3-(1-aminoethyl)phenoxy]butyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride |
| SMILES | CC(N)c1cccc(OCCCCN2CCN(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)c1.Cl |
| InChI | InChI=1S/C29H37N5O4.ClH/c1-20(30)21-5-4-6-24(18-21)38-16-3-2-11-32-12-14-33(15-13-32)23-7-8-25-22(17-23)19-34(29(25)37)26-9-10-27(35)31-28(26)36;/h4-8,17-18,20,26H,2-3,9-16,19,30H2,1H3,(H,31,35,36);1H |
| InChIKey | NGEPBDCHGPZMQC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.11 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|