C38H53N5O7 — CID 164593037
tert-butyl N-[(1R)-1-[3-[6-[2-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]ethoxy]hexoxy]phenyl]ethyl]carbamate (PubChem CID 164593037) has the molecular formula C38H53N5O7 and a molecular weight of 691.87 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[3-[6-[2-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]ethoxy]hexoxy]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[3-[6-[2-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]ethoxy]hexoxy]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 164593037 |
| Molecular Formula | C38H53N5O7 |
| Molecular Weight | 691.87 g/mol |
| Exact Mass | 691.39 |
| IUPAC Name | tert-butyl N-[(1R)-1-[3-[6-[2-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]ethoxy]hexoxy]phenyl]ethyl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)c1cccc(OCCCCCCOCCN2CCN(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)c1 |
| InChI | InChI=1S/C38H53N5O7/c1-27(39-37(47)50-38(2,3)4)28-10-9-11-31(25-28)49-22-8-6-5-7-21-48-23-20-41-16-18-42(19-17-41)30-12-13-32-29(24-30)26-43(36(32)46)33-14-15-34(44)40-35(33)45/h9-13,24-25,27,33H,5-8,14-23,26H2,1-4H3,(H,39,47)(H,40,44,45)/t27-,33?/m1/s1 |
| InChIKey | NWYNGXQSDBRACQ-KOBZZRQBSA-N |
| XLogP | 4.81 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|