C33H45N5O5 — CID 164592631
3-[6-[4-[2-[6-[3-[(1R)-1-aminoethyl]phenoxy]hexoxy]ethyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 164592631) has the molecular formula C33H45N5O5 and a molecular weight of 591.75 g/mol. Its IUPAC name is 3-[6-[4-[2-[6-[3-[(1R)-1-aminoethyl]phenoxy]hexoxy]ethyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[2-[6-[3-[(1R)-1-aminoethyl]phenoxy]hexoxy]ethyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164592631 |
| Molecular Formula | C33H45N5O5 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.34 |
| IUPAC Name | 3-[6-[4-[2-[6-[3-[(1R)-1-aminoethyl]phenoxy]hexoxy]ethyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C[C@@H](N)c1cccc(OCCCCCCOCCN2CCN(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)c1 |
| InChI | InChI=1S/C33H45N5O5/c1-24(34)25-7-6-8-28(22-25)43-19-5-3-2-4-18-42-20-17-36-13-15-37(16-14-36)27-9-10-29-26(21-27)23-38(33(29)41)30-11-12-31(39)35-32(30)40/h6-10,21-22,24,30H,2-5,11-20,23,34H2,1H3,(H,35,39,40)/t24-,30?/m1/s1 |
| InChIKey | RSKXRVNABMAUNV-DDAUYOFQSA-N |
| XLogP | 3.25 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|