C43H61N7O4 — CID 166484398
N-[[5-[1-[[3-[6-[4-(6-amino-3-pyridinyl)piperazin-1-yl]hexoxy]phenyl]methyl]piperidin-4-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide;ethane (PubChem CID 166484398) has the molecular formula C43H61N7O4 and a molecular weight of 740.01 g/mol. Its IUPAC name is N-[[5-[1-[[3-[6-[4-(6-amino-3-pyridinyl)piperazin-1-yl]hexoxy]phenyl]methyl]piperidin-4-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide;ethane.
| Compound Name | N-[[5-[1-[[3-[6-[4-(6-amino-3-pyridinyl)piperazin-1-yl]hexoxy]phenyl]methyl]piperidin-4-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide;ethane |
|---|---|
| PubChem CID | 166484398 |
| Molecular Formula | C43H61N7O4 |
| Molecular Weight | 740.01 g/mol |
| Exact Mass | 739.48 |
| IUPAC Name | N-[[5-[1-[[3-[6-[4-(6-amino-3-pyridinyl)piperazin-1-yl]hexoxy]phenyl]methyl]piperidin-4-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide;ethane |
| SMILES | CC.Cc1ccc(C2CCN(Cc3cccc(OCCCCCCN4CCN(c5ccc(N)nc5)CC4)c3)CC2)cc1CN(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C41H55N7O4.C2H6/c1-31-9-10-34(26-35(31)29-48(30-49)38-12-14-40(50)44-41(38)51)33-15-18-46(19-16-33)28-32-7-6-8-37(25-32)52-24-5-3-2-4-17-45-20-22-47(23-21-45)36-11-13-39(42)43-27-36;1-2/h6-11,13,25-27,30,33,38H,2-5,12,14-24,28-29H2,1H3,(H2,42,43)(H,44,50,51);1-2H3 |
| InChIKey | VQKQSYGQYCOMEJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.01 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|