C35H44ClN7O3 — CID 178026193
5-chloropyrimidin-2-amine;N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-5-[1-[(4-piperidin-1-ylphenyl)methyl]piperidin-4-yl]phenyl]methyl]formamide (PubChem CID 178026193) has the molecular formula C35H44ClN7O3 and a molecular weight of 646.24 g/mol. Its IUPAC name is 5-chloropyrimidin-2-amine;N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-5-[1-[(4-piperidin-1-ylphenyl)methyl]piperidin-4-yl]phenyl]methyl]formamide.
| Compound Name | 5-chloropyrimidin-2-amine;N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-5-[1-[(4-piperidin-1-ylphenyl)methyl]piperidin-4-yl]phenyl]methyl]formamide |
|---|---|
| PubChem CID | 178026193 |
| Molecular Formula | C35H44ClN7O3 |
| Molecular Weight | 646.24 g/mol |
| Exact Mass | 645.32 |
| IUPAC Name | 5-chloropyrimidin-2-amine;N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-5-[1-[(4-piperidin-1-ylphenyl)methyl]piperidin-4-yl]phenyl]methyl]formamide |
| SMILES | Cc1ccc(C2CCN(Cc3ccc(N4CCCCC4)cc3)CC2)cc1CN(C=O)C1CCC(=O)NC1=O.Nc1ncc(Cl)cn1 |
| InChI | InChI=1S/C31H40N4O3.C4H4ClN3/c1-23-5-8-26(19-27(23)21-35(22-36)29-11-12-30(37)32-31(29)38)25-13-17-33(18-14-25)20-24-6-9-28(10-7-24)34-15-3-2-4-16-34;5-3-1-7-4(6)8-2-3/h5-10,19,22,25,29H,2-4,11-18,20-21H2,1H3,(H,32,37,38);1-2H,(H2,6,7,8) |
| InChIKey | SWOVZQXPFAZARL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.24 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|