C32H42N4O4 — CID 130312138
N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-6-[[4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]phenyl]methoxy]phenyl]methyl]formamide (PubChem CID 130312138) has the molecular formula C32H42N4O4 and a molecular weight of 546.71 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-6-[[4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]phenyl]methoxy]phenyl]methyl]formamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-6-[[4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]phenyl]methoxy]phenyl]methyl]formamide |
|---|---|
| PubChem CID | 130312138 |
| Molecular Formula | C32H42N4O4 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-6-[[4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]phenyl]methoxy]phenyl]methyl]formamide |
| SMILES | Cc1cccc(OCc2ccc(CN3CCC(N4CCCCC4)CC3)cc2)c1CN(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C32H42N4O4/c1-24-6-5-7-30(28(24)21-36(23-37)29-12-13-31(38)33-32(29)39)40-22-26-10-8-25(9-11-26)20-34-18-14-27(15-19-34)35-16-3-2-4-17-35/h5-11,23,27,29H,2-4,12-22H2,1H3,(H,33,38,39) |
| InChIKey | PBPJMDNPUHGJMV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|