C15H21N3O3 — CID 176968224
3-[4-(2-aminoethoxy)-N,2-dimethylanilino]piperidine-2,6-dione (PubChem CID 176968224) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-[4-(2-aminoethoxy)-N,2-dimethylanilino]piperidine-2,6-dione.
| Compound Name | 3-[4-(2-aminoethoxy)-N,2-dimethylanilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176968224 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-[4-(2-aminoethoxy)-N,2-dimethylanilino]piperidine-2,6-dione |
| SMILES | Cc1cc(OCCN)ccc1N(C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H21N3O3/c1-10-9-11(21-8-7-16)3-4-12(10)18(2)13-5-6-14(19)17-15(13)20/h3-4,9,13H,5-8,16H2,1-2H3,(H,17,19,20) |
| InChIKey | ZQOAUCKZROLUEP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|