About 4-(2-aminoethoxy)-2-methylaniline;dihydrochloride
4-(2-aminoethoxy)-2-methylaniline;dihydrochloride (PubChem CID 164607051) has the molecular formula C9H16Cl2N2O
and a molecular weight of 239.15 g/mol. Its IUPAC name is 4-(2-aminoethoxy)-2-methylaniline;dihydrochloride.
Molecular Properties
| Compound Name | 4-(2-aminoethoxy)-2-methylaniline;dihydrochloride |
| PubChem CID | 164607051 |
| Molecular Formula | C9H16Cl2N2O |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 4-(2-aminoethoxy)-2-methylaniline;dihydrochloride |
| SMILES | Cc1cc(OCCN)ccc1N.Cl.Cl |
| InChI | InChI=1S/C9H14N2O.2ClH/c1-7-6-8(12-5-4-10)2-3-9(7)11;;/h2-3,6H,4-5,10-11H2,1H3;2*1H |
| InChIKey | JRUFGFJEBJMVEJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminoethoxy)-2-methylaniline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethoxy)-2-methylaniline;dihydrochloride?
The IUPAC name of 4-(2-aminoethoxy)-2-methylaniline;dihydrochloride (CID 164607051) is 4-(2-aminoethoxy)-2-methylaniline;dihydrochloride.
What is the SMILES notation for 4-(2-aminoethoxy)-2-methylaniline;dihydrochloride?
The canonical SMILES for 4-(2-aminoethoxy)-2-methylaniline;dihydrochloride is Cc1cc(OCCN)ccc1N.Cl.Cl.
What is the InChIKey of 4-(2-aminoethoxy)-2-methylaniline;dihydrochloride?
The InChIKey is JRUFGFJEBJMVEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O.2ClH/c1-7-6-8(12-5-4-10)2-3-9(7)11;;/h2-3,6H,4-5,10-11H2,1H3;2*1H.
What are the key properties of 4-(2-aminoethoxy)-2-methylaniline;dihydrochloride?
4-(2-aminoethoxy)-2-methylaniline;dihydrochloride has a molecular weight of 239.15 g/mol, XLogP of 1.76, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethoxy)-2-methylaniline;dihydrochloride is sourced from PubChem (CID 164607051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).