C14H21NO4 — CID 162882457
(3S)-3-[(E,2R)-2-hydroxy-5-methyl-4-oxooct-5-enyl]piperidine-2,6-dione (PubChem CID 162882457) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is (3S)-3-[(E,2R)-2-hydroxy-5-methyl-4-oxooct-5-enyl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[(E,2R)-2-hydroxy-5-methyl-4-oxooct-5-enyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162882457 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | (3S)-3-[(E,2R)-2-hydroxy-5-methyl-4-oxooct-5-enyl]piperidine-2,6-dione |
| SMILES | CC/C=C(\C)C(=O)C[C@H](O)C[C@@H]1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H21NO4/c1-3-4-9(2)12(17)8-11(16)7-10-5-6-13(18)15-14(10)19/h4,10-11,16H,3,5-8H2,1-2H3,(H,15,18,19)/b9-4+/t10-,11+/m0/s1 |
| InChIKey | ZMMFJEPVGYCTIN-LTJOXERKSA-N |
| XLogP | 1.11 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|