C8H11NO4 — CID 138460854
methyl 2-(2,6-dioxopiperidin-3-yl)acetate (PubChem CID 138460854) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is methyl 2-(2,6-dioxopiperidin-3-yl)acetate.
| Compound Name | methyl 2-(2,6-dioxopiperidin-3-yl)acetate |
|---|---|
| PubChem CID | 138460854 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | methyl 2-(2,6-dioxopiperidin-3-yl)acetate |
| SMILES | COC(=O)CC1CCC(=O)NC1=O |
| InChI | InChI=1S/C8H11NO4/c1-13-7(11)4-5-2-3-6(10)9-8(5)12/h5H,2-4H2,1H3,(H,9,10,12) |
| InChIKey | NEFANJSLGZQYOY-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|