C12H21NO5 — CID 104567454
3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]piperidine-2,6-dione (PubChem CID 104567454) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]piperidine-2,6-dione.
| Compound Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 104567454 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]piperidine-2,6-dione |
| SMILES | COCCOCCOCCC1CCC(=O)NC1=O |
| InChI | InChI=1S/C12H21NO5/c1-16-6-7-18-9-8-17-5-4-10-2-3-11(14)13-12(10)15/h10H,2-9H2,1H3,(H,13,14,15) |
| InChIKey | RUPZAQAXUUQFEA-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|