C12H16N2O5 — CID 146096913
(2-oxopiperidin-3-yl) 2-(2,6-dioxopiperidin-3-yl)acetate (PubChem CID 146096913) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is (2-oxopiperidin-3-yl) 2-(2,6-dioxopiperidin-3-yl)acetate.
| Compound Name | (2-oxopiperidin-3-yl) 2-(2,6-dioxopiperidin-3-yl)acetate |
|---|---|
| PubChem CID | 146096913 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (2-oxopiperidin-3-yl) 2-(2,6-dioxopiperidin-3-yl)acetate |
| SMILES | O=C1CCC(CC(=O)OC2CCCNC2=O)C(=O)N1 |
| InChI | InChI=1S/C12H16N2O5/c15-9-4-3-7(11(17)14-9)6-10(16)19-8-2-1-5-13-12(8)18/h7-8H,1-6H2,(H,13,18)(H,14,15,17) |
| InChIKey | JKPXBHNYXVSXGV-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|