About (2-oxoazepan-3-yl) carbamate
(2-oxoazepan-3-yl) carbamate (PubChem CID 175088958) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is (2-oxoazepan-3-yl) carbamate.
Molecular Properties
| Compound Name | (2-oxoazepan-3-yl) carbamate |
| PubChem CID | 175088958 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | (2-oxoazepan-3-yl) carbamate |
| SMILES | NC(=O)OC1CCCCNC1=O |
| InChI | InChI=1S/C7H12N2O3/c8-7(11)12-5-3-1-2-4-9-6(5)10/h5H,1-4H2,(H2,8,11)(H,9,10) |
| InChIKey | YQYVERGHSFPHFE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-oxoazepan-3-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxoazepan-3-yl) carbamate?
The IUPAC name of (2-oxoazepan-3-yl) carbamate (CID 175088958) is (2-oxoazepan-3-yl) carbamate.
What is the SMILES notation for (2-oxoazepan-3-yl) carbamate?
The canonical SMILES for (2-oxoazepan-3-yl) carbamate is NC(=O)OC1CCCCNC1=O.
What is the InChIKey of (2-oxoazepan-3-yl) carbamate?
The InChIKey is YQYVERGHSFPHFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3/c8-7(11)12-5-3-1-2-4-9-6(5)10/h5H,1-4H2,(H2,8,11)(H,9,10).
What are the key properties of (2-oxoazepan-3-yl) carbamate?
(2-oxoazepan-3-yl) carbamate has a molecular weight of 172.18 g/mol, XLogP of -0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxoazepan-3-yl) carbamate is sourced from PubChem (CID 175088958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).