C15H21N3O3 — CID 61323521
(2-oxoazepan-3-yl) 5-amino-2-(dimethylamino)benzoate (PubChem CID 61323521) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is (2-oxoazepan-3-yl) 5-amino-2-(dimethylamino)benzoate.
| Compound Name | (2-oxoazepan-3-yl) 5-amino-2-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 61323521 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (2-oxoazepan-3-yl) 5-amino-2-(dimethylamino)benzoate |
| SMILES | CN(C)c1ccc(N)cc1C(=O)OC1CCCCNC1=O |
| InChI | InChI=1S/C15H21N3O3/c1-18(2)12-7-6-10(16)9-11(12)15(20)21-13-5-3-4-8-17-14(13)19/h6-7,9,13H,3-5,8,16H2,1-2H3,(H,17,19) |
| InChIKey | VPFQBLFVZGYBLN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|