About (2-oxoazepan-3-yl) nitrate
(2-oxoazepan-3-yl) nitrate (PubChem CID 134716136) has the molecular formula C6H10N2O4
and a molecular weight of 174.16 g/mol. Its IUPAC name is (2-oxoazepan-3-yl) nitrate.
Molecular Properties
| Compound Name | (2-oxoazepan-3-yl) nitrate |
| PubChem CID | 134716136 |
| Molecular Formula | C6H10N2O4 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | (2-oxoazepan-3-yl) nitrate |
| SMILES | O=C1NCCCCC1O[N+](=O)[O-] |
| InChI | InChI=1S/C6H10N2O4/c9-6-5(12-8(10)11)3-1-2-4-7-6/h5H,1-4H2,(H,7,9) |
| InChIKey | PJCUSDJKZLARFS-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-oxoazepan-3-yl) nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxoazepan-3-yl) nitrate?
The IUPAC name of (2-oxoazepan-3-yl) nitrate (CID 134716136) is (2-oxoazepan-3-yl) nitrate.
What is the SMILES notation for (2-oxoazepan-3-yl) nitrate?
The canonical SMILES for (2-oxoazepan-3-yl) nitrate is O=C1NCCCCC1O[N+](=O)[O-].
What is the InChIKey of (2-oxoazepan-3-yl) nitrate?
The InChIKey is PJCUSDJKZLARFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O4/c9-6-5(12-8(10)11)3-1-2-4-7-6/h5H,1-4H2,(H,7,9).
What are the key properties of (2-oxoazepan-3-yl) nitrate?
(2-oxoazepan-3-yl) nitrate has a molecular weight of 174.16 g/mol, XLogP of -0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxoazepan-3-yl) nitrate is sourced from PubChem (CID 134716136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).