C12H20N2O3 — CID 30033551
methyl 2-[(3R,5aS,9aR)-4-oxo-1,2,3,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]diazepin-3-yl]acetate (PubChem CID 30033551) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is methyl 2-[(3R,5aS,9aR)-4-oxo-1,2,3,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]diazepin-3-yl]acetate.
| Compound Name | methyl 2-[(3R,5aS,9aR)-4-oxo-1,2,3,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]diazepin-3-yl]acetate |
|---|---|
| PubChem CID | 30033551 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | methyl 2-[(3R,5aS,9aR)-4-oxo-1,2,3,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]diazepin-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CN[C@@H]2CCCC[C@@H]2NC1=O |
| InChI | InChI=1S/C12H20N2O3/c1-17-11(15)6-8-7-13-9-4-2-3-5-10(9)14-12(8)16/h8-10,13H,2-7H2,1H3,(H,14,16)/t8-,9-,10+/m1/s1 |
| InChIKey | LFPMYLXHLRBOCF-BBBLOLIVSA-N |
| XLogP | 0.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |