C18H26N4O6 — CID 175152046
N',N'-bis(2,6-dioxopiperidin-3-yl)octanediamide (PubChem CID 175152046) has the molecular formula C18H26N4O6 and a molecular weight of 394.43 g/mol. Its IUPAC name is N',N'-bis(2,6-dioxopiperidin-3-yl)octanediamide.
| Compound Name | N',N'-bis(2,6-dioxopiperidin-3-yl)octanediamide |
|---|---|
| PubChem CID | 175152046 |
| Molecular Formula | C18H26N4O6 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N',N'-bis(2,6-dioxopiperidin-3-yl)octanediamide |
| SMILES | NC(=O)CCCCCCC(=O)N(C1CCC(=O)NC1=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H26N4O6/c19-13(23)5-3-1-2-4-6-16(26)22(11-7-9-14(24)20-17(11)27)12-8-10-15(25)21-18(12)28/h11-12H,1-10H2,(H2,19,23)(H,20,24,27)(H,21,25,28) |
| InChIKey | VSPPUPDNPSHYQR-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|