C21H26N4O6 — CID 171591892
N'-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-N'-hydroxyoctanediamide (PubChem CID 171591892) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is N'-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-N'-hydroxyoctanediamide.
| Compound Name | N'-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 171591892 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N'-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-N'-hydroxyoctanediamide |
| SMILES | NC(=O)CCCCCCC(=O)N(O)c1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H26N4O6/c22-17(26)8-3-1-2-4-9-19(28)25(31)15-7-5-6-13-14(15)12-24(21(13)30)16-10-11-18(27)23-20(16)29/h5-7,16,31H,1-4,8-12H2,(H2,22,26)(H,23,27,29) |
| InChIKey | FXKQBGMZBZFMPM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|