C25H27N3O5 — CID 141341746
[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-(5-phenylpentyl)carbamic acid (PubChem CID 141341746) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-(5-phenylpentyl)carbamic acid.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-(5-phenylpentyl)carbamic acid |
|---|---|
| PubChem CID | 141341746 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-(5-phenylpentyl)carbamic acid |
| SMILES | O=C1CCC(N2Cc3c(cccc3N(CCCCCc3ccccc3)C(=O)O)C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H27N3O5/c29-22-14-13-21(23(30)26-22)28-16-19-18(24(28)31)11-7-12-20(19)27(25(32)33)15-6-2-5-10-17-8-3-1-4-9-17/h1,3-4,7-9,11-12,21H,2,5-6,10,13-16H2,(H,32,33)(H,26,29,30) |
| InChIKey | NGXQBMBRDAPRIX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|