C23H31N3O5 — CID 175565696
[tert-butyl-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino] hexanoate (PubChem CID 175565696) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is [tert-butyl-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino] hexanoate.
| Compound Name | [tert-butyl-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino] hexanoate |
|---|---|
| PubChem CID | 175565696 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | [tert-butyl-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino] hexanoate |
| SMILES | CCCCCC(=O)ON(c1cccc2c1CN(C1CCC(=O)NC1=O)C2=O)C(C)(C)C |
| InChI | InChI=1S/C23H31N3O5/c1-5-6-7-11-20(28)31-26(23(2,3)4)17-10-8-9-15-16(17)14-25(22(15)30)18-12-13-19(27)24-21(18)29/h8-10,18H,5-7,11-14H2,1-4H3,(H,24,27,29) |
| InChIKey | RUGDIJQLUBGCMD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|