C8H13N3O4 — CID 22719144
butanediamide;pyrrolidine-2,5-dione (PubChem CID 22719144) has the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. Its IUPAC name is butanediamide;pyrrolidine-2,5-dione.
| Compound Name | butanediamide;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 22719144 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | butanediamide;pyrrolidine-2,5-dione |
| SMILES | NC(=O)CCC(N)=O.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C4H8N2O2.C4H5NO2/c5-3(7)1-2-4(6)8;6-3-1-2-4(7)5-3/h1-2H2,(H2,5,7)(H2,6,8);1-2H2,(H,5,6,7) |
| InChIKey | GLOMEHVOOBAHKR-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|