C11H15N3O3 — CID 163850655
(Z)-N-(2,6-dioxo-1,3-diazinan-4-yl)-2-methylidenehex-3-enamide (PubChem CID 163850655) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is (Z)-N-(2,6-dioxo-1,3-diazinan-4-yl)-2-methylidenehex-3-enamide.
| Compound Name | (Z)-N-(2,6-dioxo-1,3-diazinan-4-yl)-2-methylidenehex-3-enamide |
|---|---|
| PubChem CID | 163850655 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | (Z)-N-(2,6-dioxo-1,3-diazinan-4-yl)-2-methylidenehex-3-enamide |
| SMILES | C=C(/C=C\CC)C(=O)NC1CC(=O)NC(=O)N1 |
| InChI | InChI=1S/C11H15N3O3/c1-3-4-5-7(2)10(16)12-8-6-9(15)14-11(17)13-8/h4-5,8H,2-3,6H2,1H3,(H,12,16)(H2,13,14,15,17)/b5-4- |
| InChIKey | OUBLUKCIUHXYPI-PLNGDYQASA-N |
| XLogP | 0.18 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|