About magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate)
magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate) (PubChem CID 122130903) has the molecular formula C10H10MgN4O8
and a molecular weight of 338.52 g/mol. Its IUPAC name is magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate).
Molecular Properties
| Compound Name | magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate) |
| PubChem CID | 122130903 |
| Molecular Formula | C10H10MgN4O8 |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate) |
| SMILES | O=C1CC(C(=O)[O-])NC(=O)N1.O=C1CC(C(=O)[O-])NC(=O)N1.[Mg+2] |
| InChI | InChI=1S/2C5H6N2O4.Mg/c2*8-3-1-2(4(9)10)6-5(11)7-3;/h2*2H,1H2,(H,9,10)(H2,6,7,8,11);/q;;+2/p-2 |
| InChIKey | BIRBOXCHRPRKLV-UHFFFAOYSA-L |
| XLogP | -5.71 |
| TPSA | 196.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | -5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate)?
The IUPAC name of magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate) (CID 122130903) is magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate).
What is the SMILES notation for magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate)?
The canonical SMILES for magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate) is O=C1CC(C(=O)[O-])NC(=O)N1.O=C1CC(C(=O)[O-])NC(=O)N1.[Mg+2].
What is the InChIKey of magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate)?
The InChIKey is BIRBOXCHRPRKLV-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H6N2O4.Mg/c2*8-3-1-2(4(9)10)6-5(11)7-3;/h2*2H,1H2,(H,9,10)(H2,6,7,8,11);/q;;+2/p-2.
What are the key properties of magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate)?
magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate) has a molecular weight of 338.52 g/mol, XLogP of -5.71, 2 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(2,6-dioxo-1,3-diazinane-4-carboxylate) is sourced from PubChem (CID 122130903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).