About methyl 2,6-dioxo-1,3-diazinane-4-carboxylate
methyl 2,6-dioxo-1,3-diazinane-4-carboxylate (PubChem CID 574666) has the molecular formula C6H8N2O4
and a molecular weight of 172.14 g/mol. Its IUPAC name is methyl 2,6-dioxo-1,3-diazinane-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2,6-dioxo-1,3-diazinane-4-carboxylate |
| PubChem CID | 574666 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | methyl 2,6-dioxo-1,3-diazinane-4-carboxylate |
| SMILES | COC(=O)C1CC(=O)NC(=O)N1 |
| InChI | InChI=1S/C6H8N2O4/c1-12-5(10)3-2-4(9)8-6(11)7-3/h3H,2H2,1H3,(H2,7,8,9,11) |
| InChIKey | LRRONAYCHITNSG-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2,6-dioxo-1,3-diazinane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,6-dioxo-1,3-diazinane-4-carboxylate?
The IUPAC name of methyl 2,6-dioxo-1,3-diazinane-4-carboxylate (CID 574666) is methyl 2,6-dioxo-1,3-diazinane-4-carboxylate.
What is the SMILES notation for methyl 2,6-dioxo-1,3-diazinane-4-carboxylate?
The canonical SMILES for methyl 2,6-dioxo-1,3-diazinane-4-carboxylate is COC(=O)C1CC(=O)NC(=O)N1.
What is the InChIKey of methyl 2,6-dioxo-1,3-diazinane-4-carboxylate?
The InChIKey is LRRONAYCHITNSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O4/c1-12-5(10)3-2-4(9)8-6(11)7-3/h3H,2H2,1H3,(H2,7,8,9,11).
What are the key properties of methyl 2,6-dioxo-1,3-diazinane-4-carboxylate?
methyl 2,6-dioxo-1,3-diazinane-4-carboxylate has a molecular weight of 172.14 g/mol, XLogP of -1.24, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,6-dioxo-1,3-diazinane-4-carboxylate is sourced from PubChem (CID 574666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).