C24H36N4O12S4 — CID 177497009
trans-tetramethyl (4R,11R)-6,9,18,21-tetraoxo-1,2,13,14-tetrathia-5,10,17,22-tetrazacyclotetracosane-4,11,16,23-tetracarboxylate (PubChem CID 177497009) has the molecular formula C24H36N4O12S4 and a molecular weight of 700.84 g/mol. Its IUPAC name is trans-tetramethyl (4R,11R)-6,9,18,21-tetraoxo-1,2,13,14-tetrathia-5,10,17,22-tetrazacyclotetracosane-4,11,16,23-tetracarboxylate.
| Compound Name | trans-tetramethyl (4R,11R)-6,9,18,21-tetraoxo-1,2,13,14-tetrathia-5,10,17,22-tetrazacyclotetracosane-4,11,16,23-tetracarboxylate |
|---|---|
| PubChem CID | 177497009 |
| Molecular Formula | C24H36N4O12S4 |
| Molecular Weight | 700.84 g/mol |
| Exact Mass | 700.12 |
| IUPAC Name | trans-tetramethyl (4R,11R)-6,9,18,21-tetraoxo-1,2,13,14-tetrathia-5,10,17,22-tetrazacyclotetracosane-4,11,16,23-tetracarboxylate |
| SMILES | COC(=O)C1CSSC[C@@H](C(=O)OC)NC(=O)CCC(=O)N[C@H](C(=O)OC)CSSCC(C(=O)OC)NC(=O)CCC(=O)N1 |
| InChI | InChI=1S/C24H36N4O12S4/c1-37-21(33)13-9-41-42-10-14(22(34)38-2)26-19(31)7-8-20(32)28-16(24(36)40-4)12-44-43-11-15(23(35)39-3)27-18(30)6-5-17(29)25-13/h13-16H,5-12H2,1-4H3,(H,25,29)(H,26,31)(H,27,30)(H,28,32)/t13-,14?,15-,16?/m0/s1 |
| InChIKey | CDOBDTHGLVYACG-UIDBIOKJSA-N |
| XLogP | -1.05 |
| TPSA | 221.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.84 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|