About methyl (3R)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylate
methyl (3R)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylate (PubChem CID 1477501) has the molecular formula C8H13NO3S
and a molecular weight of 203.26 g/mol. Its IUPAC name is methyl (3R)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylate.
Analyze methyl (3R)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylate?
The IUPAC name of methyl (3R)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylate (CID 1477501) is methyl (3R)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylate.
What is the SMILES notation for methyl (3R)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylate?
The canonical SMILES for methyl (3R)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylate is COC(=O)[C@@H]1CSC(C)(C)C(=O)N1.
What is the InChIKey of methyl (3R)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylate?
The InChIKey is WDOAZFWCCYKHLM-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H13NO3S/c1-8(2)7(11)9-5(4-13-8)6(10)12-3/h5H,4H2,1-3H3,(H,9,11)/t5-/m0/s1.
What are the key properties of methyl (3R)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylate?
methyl (3R)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylate has a molecular weight of 203.26 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylate is sourced from PubChem (CID 1477501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).