C15H21N3O3S — CID 126442026
(3R)-6,6-dimethyl-5-oxo-N-(3-pyridin-3-yloxypropyl)thiomorpholine-3-carboxamide (PubChem CID 126442026) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is (3R)-6,6-dimethyl-5-oxo-N-(3-pyridin-3-yloxypropyl)thiomorpholine-3-carboxamide.
| Compound Name | (3R)-6,6-dimethyl-5-oxo-N-(3-pyridin-3-yloxypropyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 126442026 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (3R)-6,6-dimethyl-5-oxo-N-(3-pyridin-3-yloxypropyl)thiomorpholine-3-carboxamide |
| SMILES | CC1(C)SC[C@@H](C(=O)NCCCOc2cccnc2)NC1=O |
| InChI | InChI=1S/C15H21N3O3S/c1-15(2)14(20)18-12(10-22-15)13(19)17-7-4-8-21-11-5-3-6-16-9-11/h3,5-6,9,12H,4,7-8,10H2,1-2H3,(H,17,19)(H,18,20)/t12-/m0/s1 |
| InChIKey | KPDFOLOQLPEVNA-LBPRGKRZSA-N |
| XLogP | 0.98 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|