C15H20N4O3S — CID 74245475
6,6-dimethyl-5-oxo-N-[2-(pyridine-3-carbonylamino)ethyl]thiomorpholine-3-carboxamide (PubChem CID 74245475) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 6,6-dimethyl-5-oxo-N-[2-(pyridine-3-carbonylamino)ethyl]thiomorpholine-3-carboxamide.
| Compound Name | 6,6-dimethyl-5-oxo-N-[2-(pyridine-3-carbonylamino)ethyl]thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 74245475 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 6,6-dimethyl-5-oxo-N-[2-(pyridine-3-carbonylamino)ethyl]thiomorpholine-3-carboxamide |
| SMILES | CC1(C)SCC(C(=O)NCCNC(=O)c2cccnc2)NC1=O |
| InChI | InChI=1S/C15H20N4O3S/c1-15(2)14(22)19-11(9-23-15)13(21)18-7-6-17-12(20)10-4-3-5-16-8-10/h3-5,8,11H,6-7,9H2,1-2H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | FXMNCKZXIBNEHR-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|