C14H22Cl2N4O2 — CID 119850152
N-[2-[(3-aminocyclopentanecarbonyl)amino]ethyl]pyridine-3-carboxamide;dihydrochloride (PubChem CID 119850152) has the molecular formula C14H22Cl2N4O2 and a molecular weight of 349.26 g/mol. Its IUPAC name is N-[2-[(3-aminocyclopentanecarbonyl)amino]ethyl]pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-[2-[(3-aminocyclopentanecarbonyl)amino]ethyl]pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119850152 |
| Molecular Formula | C14H22Cl2N4O2 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[2-[(3-aminocyclopentanecarbonyl)amino]ethyl]pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1CCC(C(=O)NCCNC(=O)c2cccnc2)C1 |
| InChI | InChI=1S/C14H20N4O2.2ClH/c15-12-4-3-10(8-12)13(19)17-6-7-18-14(20)11-2-1-5-16-9-11;;/h1-2,5,9-10,12H,3-4,6-8,15H2,(H,17,19)(H,18,20);2*1H |
| InChIKey | BRIGSXJGWAIXCJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|