C19H28N4O2 — CID 97203330
N-[2-[[(3S)-1-cyclopentylpiperidine-3-carbonyl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 97203330) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[2-[[(3S)-1-cyclopentylpiperidine-3-carbonyl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[(3S)-1-cyclopentylpiperidine-3-carbonyl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 97203330 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | N-[2-[[(3S)-1-cyclopentylpiperidine-3-carbonyl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)[C@H]1CCCN(C2CCCC2)C1)c1cccnc1 |
| InChI | InChI=1S/C19H28N4O2/c24-18(15-5-3-9-20-13-15)21-10-11-22-19(25)16-6-4-12-23(14-16)17-7-1-2-8-17/h3,5,9,13,16-17H,1-2,4,6-8,10-12,14H2,(H,21,24)(H,22,25)/t16-/m0/s1 |
| InChIKey | AIFGERMAAWWXJS-INIZCTEOSA-N |
| XLogP | 1.58 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|