C14H22Cl2N4O3 — CID 120798153
N-[2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]ethyl]pyridine-3-carboxamide;dihydrochloride (PubChem CID 120798153) has the molecular formula C14H22Cl2N4O3 and a molecular weight of 365.26 g/mol. Its IUPAC name is N-[2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]ethyl]pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-[2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]ethyl]pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120798153 |
| Molecular Formula | C14H22Cl2N4O3 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]ethyl]pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC[C@H]1CC[C@@H](C(=O)NCCNC(=O)c2cccnc2)O1 |
| InChI | InChI=1S/C14H20N4O3.2ClH/c15-8-11-3-4-12(21-11)14(20)18-7-6-17-13(19)10-2-1-5-16-9-10;;/h1-2,5,9,11-12H,3-4,6-8,15H2,(H,17,19)(H,18,20);2*1H/t11-,12+;;/m1../s1 |
| InChIKey | NYROTYVOWWNMFZ-QBKBNCOFSA-N |
| XLogP | 0.28 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|