C15H21FN2O2S — CID 120784458
(2S,5R)-5-(aminomethyl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]oxolane-2-carboxamide (PubChem CID 120784458) has the molecular formula C15H21FN2O2S and a molecular weight of 312.41 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120784458 |
| Molecular Formula | C15H21FN2O2S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]oxolane-2-carboxamide |
| SMILES | NC[C@H]1CC[C@@H](C(=O)NCCSCc2ccccc2F)O1 |
| InChI | InChI=1S/C15H21FN2O2S/c16-13-4-2-1-3-11(13)10-21-8-7-18-15(19)14-6-5-12(9-17)20-14/h1-4,12,14H,5-10,17H2,(H,18,19)/t12-,14+/m1/s1 |
| InChIKey | KGRLWSQZGAKWOH-OCCSQVGLSA-N |
| XLogP | 1.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|