C13H18ClN3O4 — CID 120785869
(2S,5R)-5-(aminomethyl)-N-[(2-nitrophenyl)methyl]oxolane-2-carboxamide;hydrochloride (PubChem CID 120785869) has the molecular formula C13H18ClN3O4 and a molecular weight of 315.76 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-[(2-nitrophenyl)methyl]oxolane-2-carboxamide;hydrochloride.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-[(2-nitrophenyl)methyl]oxolane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120785869 |
| Molecular Formula | C13H18ClN3O4 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-[(2-nitrophenyl)methyl]oxolane-2-carboxamide;hydrochloride |
| SMILES | Cl.NC[C@H]1CC[C@@H](C(=O)NCc2ccccc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C13H17N3O4.ClH/c14-7-10-5-6-12(20-10)13(17)15-8-9-3-1-2-4-11(9)16(18)19;/h1-4,10,12H,5-8,14H2,(H,15,17);1H/t10-,12+;/m1./s1 |
| InChIKey | HYMYHVSBDHAGDA-IYJPBCIQSA-N |
| XLogP | 1.14 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|