C15H20ClF3N4O4 — CID 120784571
(2S,5R)-5-(aminomethyl)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]oxolane-2-carboxamide;hydrochloride (PubChem CID 120784571) has the molecular formula C15H20ClF3N4O4 and a molecular weight of 412.80 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]oxolane-2-carboxamide;hydrochloride.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]oxolane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120784571 |
| Molecular Formula | C15H20ClF3N4O4 |
| Molecular Weight | 412.80 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]oxolane-2-carboxamide;hydrochloride |
| SMILES | Cl.NC[C@H]1CC[C@@H](C(=O)NCCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C15H19F3N4O4.ClH/c16-15(17,18)9-1-3-11(12(7-9)22(24)25)20-5-6-21-14(23)13-4-2-10(8-19)26-13;/h1,3,7,10,13,20H,2,4-6,8,19H2,(H,21,23);1H/t10-,13+;/m1./s1 |
| InChIKey | CYBMRCCNLPEWBL-HTKOBJQYSA-N |
| XLogP | 2.07 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.80 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|